Products 203313-55-7

CAS 203313-55-7 is the registry number for Indobufen Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[4-(1-carboxypropyl)anilino]methyl]benzoic acid (CAS 203313-55-7) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: 2-[[4-(1-carboxypropyl)anilino]methyl]benzoic acid. InChIKey: PUDSPPBUDJMJPL-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19NO4
Molecular weight313.3 g/mol
IUPAC name2-[[4-(1-carboxypropyl)anilino]methyl]benzoic acid
InChIKeyPUDSPPBUDJMJPL-UHFFFAOYSA-N
SMILESCCC(C1=CC=C(C=C1)NCC2=CC=CC=C2C(=O)O)C(=O)O

Computed by PubChem (NCBI)