Products 203578-31-8
CAS 203578-31-8 is the registry number for Morpholine-d9, 98 atom % D, min 97% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
2,2,3,3,4,5,5,6,6-nonadeuteriomorpholine (CAS 203578-31-8) is a chemical compound with the molecular formula C4H9NO and a molecular weight of 96.18 g/mol. IUPAC name: 2,2,3,3,4,5,5,6,6-nonadeuteriomorpholine. InChIKey: YNAVUWVOSKDBBP-KLRAWXKOSA-N.
| Molecular formula | C4H9NO |
|---|---|
| Molecular weight | 96.18 g/mol |
| IUPAC name | 2,2,3,3,4,5,5,6,6-nonadeuteriomorpholine |
| InChIKey | YNAVUWVOSKDBBP-KLRAWXKOSA-N |
| SMILES | [2H]C1(C(OC(C(N1[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)