CAS 203664-61-3 is the registry number for tert-Butyl 4-(2,2-dibromovinyl)piperidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 10g, 25g.
Tert-butyl 4-(2,2-dibromoethenyl)piperidine-1-carboxylate (CAS 203664-61-3) is a chemical compound with the molecular formula C12H19Br2NO2 and a molecular weight of 369.09 g/mol. IUPAC name: tert-butyl 4-(2,2-dibromoethenyl)piperidine-1-carboxylate. InChIKey: MBNHUCDXSFFRLG-UHFFFAOYSA-N.
| Molecular formula | C12H19Br2NO2 |
|---|---|
| Molecular weight | 369.09 g/mol |
| IUPAC name | tert-butyl 4-(2,2-dibromoethenyl)piperidine-1-carboxylate |
| InChIKey | MBNHUCDXSFFRLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C=C(Br)Br |
Computed by PubChem (NCBI)