Products 2869050-15-5
CAS 2869050-15-5 is the registry number for tert-butyl 1,1-dibromo-6-azaspiro[2.5]octane-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 2,2-dibromo-6-azaspiro[2.5]octane-6-carboxylate (CAS 2869050-15-5) is a chemical compound with the molecular formula C12H19Br2NO2 and a molecular weight of 369.09 g/mol. IUPAC name: tert-butyl 2,2-dibromo-6-azaspiro[2.5]octane-6-carboxylate. InChIKey: IVZOISUKWYQWAH-UHFFFAOYSA-N.
| Molecular formula | C12H19Br2NO2 |
|---|---|
| Molecular weight | 369.09 g/mol |
| IUPAC name | tert-butyl 2,2-dibromo-6-azaspiro[2.5]octane-6-carboxylate |
| InChIKey | IVZOISUKWYQWAH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC2(Br)Br |
Computed by PubChem (NCBI)