Products 851882-50-3
CAS 851882-50-3 is the registry number for tert-Butyl 3-(2,2-dibromovinyl)piperidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Tert-butyl 3-(2,2-dibromoethenyl)piperidine-1-carboxylate (CAS 851882-50-3) is a chemical compound with the molecular formula C12H19Br2NO2 and a molecular weight of 369.09 g/mol. IUPAC name: tert-butyl 3-(2,2-dibromoethenyl)piperidine-1-carboxylate. InChIKey: JLLHQGDVSWDHAL-UHFFFAOYSA-N.
| Molecular formula | C12H19Br2NO2 |
|---|---|
| Molecular weight | 369.09 g/mol |
| IUPAC name | tert-butyl 3-(2,2-dibromoethenyl)piperidine-1-carboxylate |
| InChIKey | JLLHQGDVSWDHAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C=C(Br)Br |
Computed by PubChem (NCBI)