CAS 203866-14-2 appears in our catalog under these names: (2S,4R)–1–(tert–Dutoxycarbonyl)–4–fluoropyrrolidine–2–carboxylic acid, Boc-L-Pro(4-F)-OH (2S,4R), (2S,4R)-1-(tert-Butoxycarbonyl)-4-fluoro-2-pyrrolidinecarboxylic Acid, >96.0%(GC)(T), Boc-trans-4-F-Pro-OH 97%, N-BOC-TRANS-4-FLUORO-L-PROLINE, 97%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 200mg, 25g, 100g, 500g, 1000g.
(2S,4R)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 203866-14-2) is a chemical compound with the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. IUPAC name: (2S,4R)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: YGWZXQOYEBWUTH-RQJHMYQMSA-N.
| Molecular formula | C10H16FNO4 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | (2S,4R)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | YGWZXQOYEBWUTH-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)F |
Computed by PubChem (NCBI)