Products 20398-59-8

CAS 20398-59-8 is the registry number for Ethyl 2-amino-2-phenylpropanoate. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-2-phenylpropanoate (CAS 20398-59-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: ethyl 2-amino-2-phenylpropanoate. InChIKey: INIZIUDFZIBLPT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO2
Molecular weight193.24 g/mol
IUPAC nameethyl 2-amino-2-phenylpropanoate
InChIKeyINIZIUDFZIBLPT-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C1=CC=CC=C1)N

Computed by PubChem (NCBI)