Products 2040-15-5
CAS 2040-15-5 appears in our catalog under these names: 1-Mesitylpropan-1-one, 95%, 2,4,6-Trimethylpropiophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg.
1-(2,4,6-trimethylphenyl)propan-1-one (CAS 2040-15-5) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)propan-1-one. InChIKey: BMMJTVCPHGOCSW-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)propan-1-one |
| InChIKey | BMMJTVCPHGOCSW-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1C)C)C |
Computed by PubChem (NCBI)
Synonyms:
1-Mesitylpropan-1-one, 2,4,6-Trimethylpropiophenone, 1-(2,4,6-trimethylphenyl)propan-1-one, 1-Propanone, 1-(2,4,6-trimethylphenyl)-, 2',4',6'-Trimethylpropiophenone, Propiomesitylene, ethyl mesityl ketone, 1-Propanone,1-(2,4,6-trimethylphenyl)-, 1-Mesityl-1-propanone #, BMMJTVCPHGOCSW-UHFFFAOYSA-N