CAS 2040-26-8 is the registry number for 1-(4-Methoxyphenyl)-2,2-dimethylpropan-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(4-methoxyphenyl)-2,2-dimethylpropan-1-one (CAS 2040-26-8) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2,2-dimethylpropan-1-one. InChIKey: IJSLNFBUJUTKGK-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2,2-dimethylpropan-1-one |
| InChIKey | IJSLNFBUJUTKGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)