CAS 204077-08-7 appears in our catalog under these names: 5-(3-Bromophenyl)-4-phenyl-4h-1,2,4-triazole-3-thiol, 95%, 5-(3-bromophenyl)-4-phenyl-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g.
3-(3-bromophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 204077-08-7) is a chemical compound with the molecular formula C14H10BrN3S and a molecular weight of 332.22 g/mol. IUPAC name: 3-(3-bromophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: YDNKKOJZQFGCRA-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 3-(3-bromophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | YDNKKOJZQFGCRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)