CAS 39243-00-0 appears in our catalog under these names: 7-Bromo-5-(pyridin-2-yl)-1H-benzo(e)(1,4)diazepine-2(3H)-thione, 7-Bromo-5-(pyridin-2-yl)-1,3-dihydro-2H-1,4-benzodiazepine-2-thione. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
7-bromo-5-pyridin-2-yl-1,3-dihydro-1,4-benzodiazepine-2-thione (CAS 39243-00-0) is a chemical compound with the molecular formula C14H10BrN3S and a molecular weight of 332.22 g/mol. IUPAC name: 7-bromo-5-pyridin-2-yl-1,3-dihydro-1,4-benzodiazepine-2-thione. InChIKey: BSIRRIYCAITNCO-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 7-bromo-5-pyridin-2-yl-1,3-dihydro-1,4-benzodiazepine-2-thione |
| InChIKey | BSIRRIYCAITNCO-UHFFFAOYSA-N |
| SMILES | C1C(=S)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=N3 |
Computed by PubChem (NCBI)