CAS 256471-39-3 is the registry number for (4-(4-bromophenyl)(2,5-thiazolyl))-3-pyridylamine. Offered by: Biosynth. Available pack sizes: 10g, 25g.
4-(4-bromophenyl)-N-pyridin-3-yl-1,3-thiazol-2-amine (CAS 256471-39-3) is a chemical compound with the molecular formula C14H10BrN3S and a molecular weight of 332.22 g/mol. IUPAC name: 4-(4-bromophenyl)-N-pyridin-3-yl-1,3-thiazol-2-amine. InChIKey: JWSLHQTYUBJJCQ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 4-(4-bromophenyl)-N-pyridin-3-yl-1,3-thiazol-2-amine |
| InChIKey | JWSLHQTYUBJJCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NC2=NC(=CS2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)