CAS 2041844-35-1 is the registry number for Rel-(2R,4R)-2-methyltetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R)-2-methyl-1,1-dioxothiane-4-carboxylic acid (CAS 2041844-35-1) is a chemical compound with the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. IUPAC name: (2R,4R)-2-methyl-1,1-dioxothiane-4-carboxylic acid. InChIKey: WJGPPSANQXLPMY-PHDIDXHHSA-N.
| Molecular formula | C7H12O4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (2R,4R)-2-methyl-1,1-dioxothiane-4-carboxylic acid |
| InChIKey | WJGPPSANQXLPMY-PHDIDXHHSA-N |
| SMILES | C[C@@H]1C[C@@H](CCS1(=O)=O)C(=O)O |
Computed by PubChem (NCBI)