CAS 1257236-76-2 is the registry number for Ethyl 1-methanesulfonylcyclopropane-1-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 500mg.
Ethyl 1-methylsulfonylcyclopropane-1-carboxylate (CAS 1257236-76-2) is a chemical compound with the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. IUPAC name: ethyl 1-methylsulfonylcyclopropane-1-carboxylate. InChIKey: NRIOFWFQSUUNDR-UHFFFAOYSA-N.
| Molecular formula | C7H12O4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | ethyl 1-methylsulfonylcyclopropane-1-carboxylate |
| InChIKey | NRIOFWFQSUUNDR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)S(=O)(=O)C |
Computed by PubChem (NCBI)