Products 167011-34-9

CAS 167011-34-9 is the registry number for Methyl tetrahydro-2H-thiopyran-3-carboxylate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 1,1-dioxothiane-3-carboxylate (CAS 167011-34-9) is a chemical compound with the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. IUPAC name: methyl 1,1-dioxothiane-3-carboxylate. InChIKey: YURANTGNNPUNMB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O4S
Molecular weight192.24 g/mol
IUPAC namemethyl 1,1-dioxothiane-3-carboxylate
InChIKeyYURANTGNNPUNMB-UHFFFAOYSA-N
SMILESCOC(=O)C1CCCS(=O)(=O)C1

Computed by PubChem (NCBI)