CAS 204322-11-2 appears in our catalog under these names: 2-(3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-oxopyridin-1(2H)-yl)acetic acid, 98+%, Fmoc-3-amino-1-carboxymethyl-pyridin-2-one, 95%, Fmoc-Acpo-OH. Offered by: AmBeed, Combi-blocks, Iris Biotech. Available pack sizes: 1g, 5g, 250mg, on request.
2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxo-1-pyridinyl]acetic acid (CAS 204322-11-2) is a chemical compound with the molecular formula C22H18N2O5 and a molecular weight of 390.4 g/mol. IUPAC name: 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxo-1-pyridinyl]acetic acid. InChIKey: FFXBMPRBLHRCQW-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O5 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-oxo-1-pyridinyl]acetic acid |
| InChIKey | FFXBMPRBLHRCQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=CN(C4=O)CC(=O)O |
Computed by PubChem (NCBI)