Products 2172042-24-7
CAS 2172042-24-7 is the registry number for 2-(1-{((9H-Fluoren-9-yl)methoxy)carbonyl}azetidin-3-yl)-1,3-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]-1,3-oxazole-4-carboxylic acid (CAS 2172042-24-7) is a chemical compound with the molecular formula C22H18N2O5 and a molecular weight of 390.4 g/mol. IUPAC name: 2-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]-1,3-oxazole-4-carboxylic acid. InChIKey: IAZZOFMTMJBHGE-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O5 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 2-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | IAZZOFMTMJBHGE-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5=NC(=CO5)C(=O)O |
Computed by PubChem (NCBI)