CAS 310451-93-5 is the registry number for 5-(4-Aminophenoxy)-2-(3,4-dimethoxyphenyl)isoindoline-1,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-aminophenoxy)-2-(3,4-dimethoxyphenyl)isoindole-1,3-dione (CAS 310451-93-5) is a chemical compound with the molecular formula C22H18N2O5 and a molecular weight of 390.4 g/mol. IUPAC name: 5-(4-aminophenoxy)-2-(3,4-dimethoxyphenyl)isoindole-1,3-dione. InChIKey: GHYHNKPGQFLOLU-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O5 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 5-(4-aminophenoxy)-2-(3,4-dimethoxyphenyl)isoindole-1,3-dione |
| InChIKey | GHYHNKPGQFLOLU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)OC4=CC=C(C=C4)N)OC |
Computed by PubChem (NCBI)