CAS 20443-03-2 appears in our catalog under these names: Dimethyl 4–oxo–1,4–dihydropyridine–2,6–dicarboxylate, Dimethyl 4-oxo-1,4-dihydropyridine-2,6-dicarboxylate 95%, Dimethyl 4-oxo-1,4-dihydropyridine-2,6-dicarboxylate, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g.
Dimethyl 4-oxo-1H-pyridine-2,6-dicarboxylate (CAS 20443-03-2) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: dimethyl 4-oxo-1H-pyridine-2,6-dicarboxylate. InChIKey: FERASHUCDLDGHK-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | dimethyl 4-oxo-1H-pyridine-2,6-dicarboxylate |
| InChIKey | FERASHUCDLDGHK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C=C(N1)C(=O)OC |
Computed by PubChem (NCBI)