Products 2044705-74-8
CAS 2044705-74-8 is the registry number for rac-(3aR,6aS)-Hexahydro-1H-furo(3,4-c)pyrrol-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.
(3aR,6aS)-1,3a,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3-one;hydrochloride (CAS 2044705-74-8) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (3aR,6aS)-1,3a,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3-one;hydrochloride. InChIKey: NQOAQBCMMKJMQP-FHAQVOQBSA-N.
| Molecular formula | C6H10ClNO2 |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | (3aR,6aS)-1,3a,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3-one;hydrochloride |
| InChIKey | NQOAQBCMMKJMQP-FHAQVOQBSA-N |
| SMILES | C1[C@H]2COC(=O)[C@H]2CN1.Cl |
Computed by PubChem (NCBI)