CAS 2044705-95-3 is the registry number for rac-Methyl (2R,5S)-5-(4-(trifluoromethyl)phenyl)oxolane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate (CAS 2044705-95-3) is a chemical compound with the molecular formula C13H13F3O3 and a molecular weight of 274.23 g/mol. IUPAC name: methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate. InChIKey: MJPNDBIPJQNUCT-MNOVXSKESA-N.
| Molecular formula | C13H13F3O3 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate |
| InChIKey | MJPNDBIPJQNUCT-MNOVXSKESA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](O1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)