CAS 2044711-36-4 is the registry number for (7S)-6,7-Dihydro-5H-cyclopenta[b]pyridin-7-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(7S)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;hydrochloride (CAS 2044711-36-4) is a chemical compound with the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. IUPAC name: (7S)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;hydrochloride. InChIKey: ZJMHTKKYRWAVTH-FJXQXJEOSA-N.
| Molecular formula | C8H11ClN2 |
|---|---|
| Molecular weight | 170.64 g/mol |
| IUPAC name | (7S)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;hydrochloride |
| InChIKey | ZJMHTKKYRWAVTH-FJXQXJEOSA-N |
| SMILES | C1CC2=C([C@H]1N)N=CC=C2.Cl |
Computed by PubChem (NCBI)