CAS 2442565-23-1 is the registry number for (R)–6,7–Dihydro–5H–cyclopenta(b)pyridin–7–amine hydrochloride. Offered by: GLPBio. Available pack sizes: 50mg.
(7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;hydrochloride (CAS 2442565-23-1) is a chemical compound with the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. IUPAC name: (7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;hydrochloride. InChIKey: ZJMHTKKYRWAVTH-OGFXRTJISA-N.
| Molecular formula | C8H11ClN2 |
|---|---|
| Molecular weight | 170.64 g/mol |
| IUPAC name | (7R)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;hydrochloride |
| InChIKey | ZJMHTKKYRWAVTH-OGFXRTJISA-N |
| SMILES | C1CC2=C([C@@H]1N)N=CC=C2.Cl |
Computed by PubChem (NCBI)