CAS 2044713-76-8 is the registry number for 1-Cyclopropyl-1,3-dihydro-2lambda6,1,3-benzothiadiazole-2,2-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-cyclopropyl-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide (CAS 2044713-76-8) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 3-cyclopropyl-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide. InChIKey: CFAIHEBXDMMBRA-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 3-cyclopropyl-1H-2lambda6,1,3-benzothiadiazole 2,2-dioxide |
| InChIKey | CFAIHEBXDMMBRA-UHFFFAOYSA-N |
| SMILES | C1CC1N2C3=CC=CC=C3NS2(=O)=O |
Computed by PubChem (NCBI)