CAS 2044796-16-7 appears in our catalog under these names: Ethyl 5-chloro-1H,1aH,6H,6aH-cyclopropa(a)indene-1-carboxylate, 95%, Ethyl 5-chloro-1H,1aH,6H,6aH-cyclopropa(A)indene-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 5-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylate (CAS 2044796-16-7) is a chemical compound with the molecular formula C13H13ClO2 and a molecular weight of 236.69 g/mol. IUPAC name: ethyl 5-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylate. InChIKey: MYVRUTSAZYJHCF-UHFFFAOYSA-N.
| Molecular formula | C13H13ClO2 |
|---|---|
| Molecular weight | 236.69 g/mol |
| IUPAC name | ethyl 5-chloro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylate |
| InChIKey | MYVRUTSAZYJHCF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2C1C3=C(C2)C(=CC=C3)Cl |
Computed by PubChem (NCBI)