CAS 2044835-25-6 appears in our catalog under these names: 4-Chloro-2-(propan-2-yl)aniline hydrochloride, 95%, 4-Chloro-2-(propan-2-yl)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-chloro-2-propan-2-ylaniline;hydrochloride (CAS 2044835-25-6) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: 4-chloro-2-propan-2-ylaniline;hydrochloride. InChIKey: YUHPVGQLCCRHFS-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | 4-chloro-2-propan-2-ylaniline;hydrochloride |
| InChIKey | YUHPVGQLCCRHFS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)Cl)N.Cl |
Computed by PubChem (NCBI)