CAS 204650-40-8 is the registry number for 5-HT2C antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aS,10bR)-8-ethyl-7-hydroxy-9-methoxy-2-methyl-1,3,4,4a,5,10b-hexahydrobenzo[h]isoquinolin-6-one (CAS 204650-40-8) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: (4aS,10bR)-8-ethyl-7-hydroxy-9-methoxy-2-methyl-1,3,4,4a,5,10b-hexahydrobenzo[h]isoquinolin-6-one. InChIKey: XKPFAVXGYLJDLN-GXFFZTMASA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | (4aS,10bR)-8-ethyl-7-hydroxy-9-methoxy-2-methyl-1,3,4,4a,5,10b-hexahydrobenzo[h]isoquinolin-6-one |
| InChIKey | XKPFAVXGYLJDLN-GXFFZTMASA-N |
| SMILES | CCC1=C(C=C2[C@@H]3CN(CC[C@H]3CC(=O)C2=C1O)C)OC |
Computed by PubChem (NCBI)