Products 204686-65-7
CAS 204686-65-7 is the registry number for (+)-Lunacrine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-8-methoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-4-one (CAS 204686-65-7) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: (2S)-8-methoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-4-one. InChIKey: FMEKJMQGMONLTQ-ZDUSSCGKSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | (2S)-8-methoxy-9-methyl-2-propan-2-yl-2,3-dihydrofuro[2,3-b]quinolin-4-one |
| InChIKey | FMEKJMQGMONLTQ-ZDUSSCGKSA-N |
| SMILES | CC(C)[C@@H]1CC2=C(O1)N(C3=C(C2=O)C=CC=C3OC)C |
Computed by PubChem (NCBI)