CAS 2050-16-0 appears in our catalog under these names: Phenacetin Impurity 10, (E)–4,4'–(Diazene–1,2–diyl)diphenol, 4,4'-Dihydroxyazobenzene, >98.0%(HPLC)(T), 4,4'-(E)-Diazene-1,2-diyldiphenol 98%, 4,4'-Azobisphenol, 98%, 98%. Offered by: Chemat Brand, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: on request, 1g, 5g, 100mg, 250mg, 25g, 10g, 2.5g.
4-[(4-hydroxyphenyl)diazenyl]phenol (CAS 2050-16-0) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)diazenyl]phenol. InChIKey: WKODVHZBYIBMOC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)diazenyl]phenol |
| InChIKey | WKODVHZBYIBMOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)