CAS 51437-66-2 appears in our catalog under these names: trans-4,4'-Azodiphenol, 4,4–(E)–Diazene–1,2–diyldiphenol. Offered by: TRC, GLPBio. Available pack sizes: 2,5g, 100mg, 1g, 250mg.
4-[(4-hydroxyphenyl)diazenyl]phenol (CAS 51437-66-2) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)diazenyl]phenol. InChIKey: WKODVHZBYIBMOC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)diazenyl]phenol |
| InChIKey | WKODVHZBYIBMOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)