CAS 2050910-30-8 is the registry number for (R)-3-(4-(3,6-Dihydro-2H-pyran-4-yl)phenyl)-2-hydroxypropanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-3-[4-(3,6-dihydro-2H-pyran-4-yl)phenyl]-2-hydroxypropanoic acid (CAS 2050910-30-8) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: (2R)-3-[4-(3,6-dihydro-2H-pyran-4-yl)phenyl]-2-hydroxypropanoic acid. InChIKey: RRIKFSXQXHUQTH-CYBMUJFWSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | (2R)-3-[4-(3,6-dihydro-2H-pyran-4-yl)phenyl]-2-hydroxypropanoic acid |
| InChIKey | RRIKFSXQXHUQTH-CYBMUJFWSA-N |
| SMILES | C1COCC=C1C2=CC=C(C=C2)C[C@H](C(=O)O)O |
Computed by PubChem (NCBI)