Products 2050910-30-8

CAS 2050910-30-8 is the registry number for (R)-3-(4-(3,6-Dihydro-2H-pyran-4-yl)phenyl)-2-hydroxypropanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2R)-3-[4-(3,6-dihydro-2H-pyran-4-yl)phenyl]-2-hydroxypropanoic acid (CAS 2050910-30-8) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: (2R)-3-[4-(3,6-dihydro-2H-pyran-4-yl)phenyl]-2-hydroxypropanoic acid. InChIKey: RRIKFSXQXHUQTH-CYBMUJFWSA-N.

Identity
Molecular formulaC14H16O4
Molecular weight248.27 g/mol
IUPAC name(2R)-3-[4-(3,6-dihydro-2H-pyran-4-yl)phenyl]-2-hydroxypropanoic acid
InChIKeyRRIKFSXQXHUQTH-CYBMUJFWSA-N
SMILESC1COCC=C1C2=CC=C(C=C2)C[C@H](C(=O)O)O

Computed by PubChem (NCBI)