CAS 2052277-16-2 is the registry number for 1H-Indole-5-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1H-indole-5-sulfonyl fluoride (CAS 2052277-16-2) is a chemical compound with the molecular formula C8H6FNO2S and a molecular weight of 199.20 g/mol. IUPAC name: 1H-indole-5-sulfonyl fluoride. InChIKey: SRSORSNYOITMAA-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2S |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 1H-indole-5-sulfonyl fluoride |
| InChIKey | SRSORSNYOITMAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C=C1S(=O)(=O)F |
Computed by PubChem (NCBI)