CAS 2055119-30-5 is the registry number for (2-Cyanophenyl)methanesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2-cyanophenyl)methanesulfonyl fluoride (CAS 2055119-30-5) is a chemical compound with the molecular formula C8H6FNO2S and a molecular weight of 199.20 g/mol. IUPAC name: (2-cyanophenyl)methanesulfonyl fluoride. InChIKey: GHPWCNBEURKKPX-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2S |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | (2-cyanophenyl)methanesulfonyl fluoride |
| InChIKey | GHPWCNBEURKKPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)F)C#N |
Computed by PubChem (NCBI)