CAS 59849-52-4 is the registry number for [(2-Fluorophenyl)sulfonyl]acetonitrile, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2-fluorophenyl)sulfonylacetonitrile (CAS 59849-52-4) is a chemical compound with the molecular formula C8H6FNO2S and a molecular weight of 199.20 g/mol. IUPAC name: 2-(2-fluorophenyl)sulfonylacetonitrile. InChIKey: JTMDWESWXCJUHR-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO2S |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-(2-fluorophenyl)sulfonylacetonitrile |
| InChIKey | JTMDWESWXCJUHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)S(=O)(=O)CC#N |
Computed by PubChem (NCBI)