CAS 6929-81-3 appears in our catalog under these names: 10–Bromoanthracene–9–carboxylic acid, 10-Bromoanthracene-9-carboxylic acid 95%, 10-Bromoanthracene-9-carboxylic acid, 95%, 95%, 10-Bromoanthracene-9-carboxylic acid, 98%(LC-MS),RG. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
10-bromoanthracene-9-carboxylic acid (CAS 6929-81-3) is a chemical compound with the molecular formula C15H9BrO2 and a molecular weight of 301.13 g/mol. IUPAC name: 10-bromoanthracene-9-carboxylic acid. InChIKey: WBDRSGFQJKKJCW-UHFFFAOYSA-N.
| Molecular formula | C15H9BrO2 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 10-bromoanthracene-9-carboxylic acid |
| InChIKey | WBDRSGFQJKKJCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Br)C(=O)O |
Computed by PubChem (NCBI)