CAS 205440-82-0 appears in our catalog under these names: Benzo(e)pyrene-d12, >95% (HPLC), Benzo(e)pyrene D12 100 µg/mL in Cyclohexane, Benzo(e)pyrene-d12, 98 atom % D, min 98% Chemical Purity, BENZO[E]PYRENE-D12, 98 ATOM % D, 98% (C&, Benzo[e]pyrene-d12, 98.9%. Offered by: TRC, Dr. Ehrenstorfer, CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1ml, 0,01g, 1 mg, 1x5ml, 5 mg.
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[e]pyrene (CAS 205440-82-0) is a chemical compound with the molecular formula C20H12 and a molecular weight of 264.4 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[e]pyrene. InChIKey: TXVHTIQJNYSSKO-AQZSQYOVSA-N.
| Molecular formula | C20H12 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[e]pyrene |
| InChIKey | TXVHTIQJNYSSKO-AQZSQYOVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C4=C3C5=C(C(=C(C(=C25)[2H])[2H])[2H])C(=C4[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)