Products 2055840-06-5
CAS 2055840-06-5 is the registry number for (9Ar)-octahydro-1h-pyrido[1,2-a]piperazine oxalic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine;oxalic acid (CAS 2055840-06-5) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine;oxalic acid. InChIKey: IZLXUBUCSXDDSG-DDWIOCJRSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine;oxalic acid |
| InChIKey | IZLXUBUCSXDDSG-DDWIOCJRSA-N |
| SMILES | C1CCN2CCNC[C@H]2C1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)