CAS 2055841-16-0 appears in our catalog under these names: 1-Phenylazetidin-3-amine dihydrochloride, 95%, 1-Phenyl-3-Azetidinamine Dihydrochloride, 1-Phenylazetidin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 250mg, 500mg.
1-phenylazetidin-3-amine;dihydrochloride (CAS 2055841-16-0) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 1-phenylazetidin-3-amine;dihydrochloride. InChIKey: UVRDDYMQRPZLIX-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 1-phenylazetidin-3-amine;dihydrochloride |
| InChIKey | UVRDDYMQRPZLIX-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=CC=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)