CAS 2056122-11-1 appears in our catalog under these names: HPK1–IN–2, HPK1-IN-2/ 99.62% (existing batch purity), HPK1-IN-2 dihydrochloride. Offered by: GLPBio, TargetMol, Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg, 1mg, 200mg.
4-amino-5-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-7H-thieno[2,3-b]pyridin-6-one (CAS 2056122-11-1) is a chemical compound with the molecular formula C19H20N6OS and a molecular weight of 380.5 g/mol. IUPAC name: 4-amino-5-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-7H-thieno[2,3-b]pyridin-6-one. InChIKey: WKFZMTSRRQSGEY-UHFFFAOYSA-N.
| Molecular formula | C19H20N6OS |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 4-amino-5-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-7H-thieno[2,3-b]pyridin-6-one |
| InChIKey | WKFZMTSRRQSGEY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=C(C5=C(NC4=O)SC=C5)N |
Computed by PubChem (NCBI)