Products 2726461-43-2
CAS 2726461-43-2 appears in our catalog under these names: RNA splicing modulator 3, RNA splicing modulator 3, 98.58%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25 mg, 5 mg, 50 mg, 10 mg.
6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-3-piperidin-4-ylthieno[3,2-d]pyrimidin-4-one (CAS 2726461-43-2) is a chemical compound with the molecular formula C19H20N6OS and a molecular weight of 380.5 g/mol. IUPAC name: 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-3-piperidin-4-ylthieno[3,2-d]pyrimidin-4-one. InChIKey: JVVCLZXWCISLFI-UHFFFAOYSA-N.
| Molecular formula | C19H20N6OS |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-3-piperidin-4-ylthieno[3,2-d]pyrimidin-4-one |
| InChIKey | JVVCLZXWCISLFI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN2C1=NC(=C2)C)C3=CC4=C(S3)C(=O)N(C=N4)C5CCNCC5 |
Computed by PubChem (NCBI)
Synonyms:
RNA splicing modulator 3, orb1982525