Products 2726461-38-5

CAS 2726461-38-5 is the registry number for RNA splicing modulator 1, 99.53%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 50 mg, 5 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

2-(2,7-dimethylindazol-5-yl)-6-piperidin-4-yl-[1,3]thiazolo[4,5-d]pyrimidin-7-one (CAS 2726461-38-5) is a chemical compound with the molecular formula C19H20N6OS and a molecular weight of 380.5 g/mol. IUPAC name: 2-(2,7-dimethylindazol-5-yl)-6-piperidin-4-yl-[1,3]thiazolo[4,5-d]pyrimidin-7-one. InChIKey: AVWASSIUWWHQFS-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N6OS
Molecular weight380.5 g/mol
IUPAC name2-(2,7-dimethylindazol-5-yl)-6-piperidin-4-yl-[1,3]thiazolo[4,5-d]pyrimidin-7-one
InChIKeyAVWASSIUWWHQFS-UHFFFAOYSA-N
SMILESCC1=CC(=CC2=CN(N=C12)C)C3=NC4=C(S3)C(=O)N(C=N4)C5CCNCC5

Computed by PubChem (NCBI)