CAS 2056916-57-3 appears in our catalog under these names: 5-Bromo-1,8-naphthyridin-2-amine, 98%, 5-Bromo-1,8-naphthyridin-2-amine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
5-bromo-1,8-naphthyridin-2-amine (CAS 2056916-57-3) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 5-bromo-1,8-naphthyridin-2-amine. InChIKey: CVHRCVWWFNSQJK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 5-bromo-1,8-naphthyridin-2-amine |
| InChIKey | CVHRCVWWFNSQJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=CC(=C21)Br)N |
Computed by PubChem (NCBI)