CAS 2057515-56-5 is the registry number for 5-Chloro-4-(5,5-dimethyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)pyridin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-4-(5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazol-3-yl)pyridin-2-amine (CAS 2057515-56-5) is a chemical compound with the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. IUPAC name: 5-chloro-4-(5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazol-3-yl)pyridin-2-amine. InChIKey: DVADGDLKHNVAJW-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4 |
|---|---|
| Molecular weight | 262.74 g/mol |
| IUPAC name | 5-chloro-4-(5,5-dimethyl-4,6-dihydropyrrolo[2,1-e]pyrazol-3-yl)pyridin-2-amine |
| InChIKey | DVADGDLKHNVAJW-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=NN2C1)C3=CC(=NC=C3Cl)N)C |
Computed by PubChem (NCBI)