Products 1532200-65-9
CAS 1532200-65-9 is the registry number for 1-[3-(4-Chlorophenyl)-1h-pyrazol-5-yl]piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]piperazine (CAS 1532200-65-9) is a chemical compound with the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. IUPAC name: 1-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]piperazine. InChIKey: MPXPRPWTQVWKDG-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4 |
|---|---|
| Molecular weight | 262.74 g/mol |
| IUPAC name | 1-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]piperazine |
| InChIKey | MPXPRPWTQVWKDG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NNC(=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)