CAS 155584-74-0 appears in our catalog under these names: 2-Chloro-3-(4-methylpiperazin-1-yl)quinoxaline, 95%, VUF 10166, VUF 10166/ 99.52% (existing batch purity), VUF 10166, VUF10166 99%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 500mg, 5mg, 25mg.
2-chloro-3-(4-methylpiperazin-1-yl)quinoxaline (CAS 155584-74-0) is a chemical compound with the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. IUPAC name: 2-chloro-3-(4-methylpiperazin-1-yl)quinoxaline. InChIKey: FFXVTQDGTKEXHF-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4 |
|---|---|
| Molecular weight | 262.74 g/mol |
| IUPAC name | 2-chloro-3-(4-methylpiperazin-1-yl)quinoxaline |
| InChIKey | FFXVTQDGTKEXHF-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3N=C2Cl |
Computed by PubChem (NCBI)