CAS 929972-57-6 is the registry number for 2-Chloro-5-(6,7,8,9-tetrahydro-5h-[1,2,4]triazolo[4,3-a]azepin-3-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)aniline (CAS 929972-57-6) is a chemical compound with the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. IUPAC name: 2-chloro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)aniline. InChIKey: DIRVGHCUQQIASL-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN4 |
|---|---|
| Molecular weight | 262.74 g/mol |
| IUPAC name | 2-chloro-5-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)aniline |
| InChIKey | DIRVGHCUQQIASL-UHFFFAOYSA-N |
| SMILES | C1CCC2=NN=C(N2CC1)C3=CC(=C(C=C3)Cl)N |
Computed by PubChem (NCBI)