Products 205754-33-2
CAS 205754-33-2 appears in our catalog under these names: 8-Hydroxy Efavirenz, 8-Hydroxy Efavirenz (~90%), 8–hydroxy Efavirenz, 8-Hydroxyefavirenz, 8-Hydroxyefavirenz, 98.0%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 0,1mg, 1mg, 50mg, 100mg, 250mg, 500mg, 1g.
(4S)-6-chloro-4-(2-cyclopropylethynyl)-8-hydroxy-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 205754-33-2) is a chemical compound with the molecular formula C14H9ClF3NO3 and a molecular weight of 331.67 g/mol. IUPAC name: (4S)-6-chloro-4-(2-cyclopropylethynyl)-8-hydroxy-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: OOVOMPCQLMFEDT-ZDUSSCGKSA-N.
| Molecular formula | C14H9ClF3NO3 |
|---|---|
| Molecular weight | 331.67 g/mol |
| IUPAC name | (4S)-6-chloro-4-(2-cyclopropylethynyl)-8-hydroxy-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | OOVOMPCQLMFEDT-ZDUSSCGKSA-N |
| SMILES | C1CC1C#C[C@]2(C3=C(C(=CC(=C3)Cl)O)NC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)