Products 205754-50-3
CAS 205754-50-3 is the registry number for rac 7-Hydroxy Efavirenz, >95% (HPLC). Offered by: TRC. Available pack sizes: 0,5mg, 10mg, 1mg.
6-chloro-4-(2-cyclopropylethynyl)-7-hydroxy-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 205754-50-3) is a chemical compound with the molecular formula C14H9ClF3NO3 and a molecular weight of 331.67 g/mol. IUPAC name: 6-chloro-4-(2-cyclopropylethynyl)-7-hydroxy-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: GZMDZAYFVCXHFM-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO3 |
|---|---|
| Molecular weight | 331.67 g/mol |
| IUPAC name | 6-chloro-4-(2-cyclopropylethynyl)-7-hydroxy-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | GZMDZAYFVCXHFM-UHFFFAOYSA-N |
| SMILES | C1CC1C#CC2(C3=CC(=C(C=C3NC(=O)O2)O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)