Products 74274-36-5
CAS 74274-36-5 appears in our catalog under these names: Acifluorfen-2-amino, >95% (HPLC), Acifluorfen-2-amino. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 1g, 25mg.
2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoic acid (CAS 74274-36-5) is a chemical compound with the molecular formula C14H9ClF3NO3 and a molecular weight of 331.67 g/mol. IUPAC name: 2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoic acid. InChIKey: ZIOSAFHXVGRRAL-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO3 |
|---|---|
| Molecular weight | 331.67 g/mol |
| IUPAC name | 2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoic acid |
| InChIKey | ZIOSAFHXVGRRAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)OC2=CC(=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)