CAS 205756-49-6 appears in our catalog under these names: 1-(2-Aminophenyl)-2,2,2-trifluoroethanol, 95+%, 1-(2-Aminophenyl)-2,2,2-trifluoroethan-1-ol, 1-(2-Aminophenyl)-2,2,2-trifluoroethanol, 95%, 95%, 1-(2-Aminophenyl)-2,2,2-trifluoroethan-1-ol, 95+%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg.
1-(2-aminophenyl)-2,2,2-trifluoroethanol (CAS 205756-49-6) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 1-(2-aminophenyl)-2,2,2-trifluoroethanol. InChIKey: MEYKEXQUMCFNCS-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 1-(2-aminophenyl)-2,2,2-trifluoroethanol |
| InChIKey | MEYKEXQUMCFNCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)O)N |
Computed by PubChem (NCBI)